C16H16N4O3 — CID 122553748
[3-(1-prop-2-enoyl-3,4-dihydro-2H-pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid (PubChem CID 122553748) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is [3-(1-prop-2-enoyl-3,4-dihydro-2H-pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid.
| Compound Name | [3-(1-prop-2-enoyl-3,4-dihydro-2H-pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid |
|---|---|
| PubChem CID | 122553748 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [3-(1-prop-2-enoyl-3,4-dihydro-2H-pyridin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]carbamic acid |
| SMILES | C=CC(=O)N1C=C(c2c[nH]c3ncc(NC(=O)O)cc23)CCC1 |
| InChI | InChI=1S/C16H16N4O3/c1-2-14(21)20-5-3-4-10(9-20)13-8-18-15-12(13)6-11(7-17-15)19-16(22)23/h2,6-9,19H,1,3-5H2,(H,17,18)(H,22,23) |
| InChIKey | CPTNCLNGNKURFN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|