C20H30N6O2 — CID 122569564
N-[(3aR,6R,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-methyl-1H-imidazole-4-carboxamide (PubChem CID 122569564) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[(3aR,6R,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-methyl-1H-imidazole-4-carboxamide.
| Compound Name | N-[(3aR,6R,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-methyl-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 122569564 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[(3aR,6R,7aS)-1-[(3-ethyl-1H-pyrazol-5-yl)methyl]-3a-methoxy-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-5-methyl-1H-imidazole-4-carboxamide |
| SMILES | CCc1cc(CN2CC[C@]3(OC)CC[C@@H](NC(=O)c4nc[nH]c4C)C[C@H]23)[nH]n1 |
| InChI | InChI=1S/C20H30N6O2/c1-4-14-9-16(25-24-14)11-26-8-7-20(28-3)6-5-15(10-17(20)26)23-19(27)18-13(2)21-12-22-18/h9,12,15,17H,4-8,10-11H2,1-3H3,(H,21,22)(H,23,27)(H,24,25)/t15-,17+,20-/m1/s1 |
| InChIKey | NLTHFNPXYXXWKY-OXFYSEKESA-N |
| XLogP | 1.95 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |