About ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate
ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate (PubChem CID 122574252) has the molecular formula C13H26O8
and a molecular weight of 310.34 g/mol. Its IUPAC name is ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate.
Molecular Properties
| Compound Name | ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate |
| PubChem CID | 122574252 |
| Molecular Formula | C13H26O8 |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate |
| SMILES | CCC(O)C(=O)OCC(C)OC(=O)C(O)CC.OCCO |
| InChI | InChI=1S/C11H20O6.C2H6O2/c1-4-8(12)10(14)16-6-7(3)17-11(15)9(13)5-2;3-1-2-4/h7-9,12-13H,4-6H2,1-3H3;3-4H,1-2H2 |
| InChIKey | DLLYVYIJVLSHAL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate?
The IUPAC name of ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate (CID 122574252) is ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate.
What is the SMILES notation for ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate?
The canonical SMILES for ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate is CCC(O)C(=O)OCC(C)OC(=O)C(O)CC.OCCO.
What is the InChIKey of ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate?
The InChIKey is DLLYVYIJVLSHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O6.C2H6O2/c1-4-8(12)10(14)16-6-7(3)17-11(15)9(13)5-2;3-1-2-4/h7-9,12-13H,4-6H2,1-3H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate?
ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate has a molecular weight of 310.34 g/mol, XLogP of -1.03, 8 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-(2-hydroxybutanoyloxy)propyl 2-hydroxybutanoate is sourced from PubChem (CID 122574252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).