C29H33F5O — CID 122578222
5-[4-[[4-(4-butylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2,3-trifluorobenzene (PubChem CID 122578222) has the molecular formula C29H33F5O and a molecular weight of 492.57 g/mol. Its IUPAC name is 5-[4-[[4-(4-butylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[[4-(4-butylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 122578222 |
| Molecular Formula | C29H33F5O |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 5-[4-[[4-(4-butylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCC1C=CC(C2CCC(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C29H33F5O/c1-2-3-4-19-5-7-20(8-6-19)21-9-13-24(14-10-21)29(33,34)35-25-15-11-22(12-16-25)23-17-26(30)28(32)27(31)18-23/h5,7,11-12,15-21,24H,2-4,6,8-10,13-14H2,1H3 |
| InChIKey | DOXLVLXGBOPJTA-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|