C21H27F3O — CID 122578043
1-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-4-fluorobenzene (PubChem CID 122578043) has the molecular formula C21H27F3O and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-4-fluorobenzene.
| Compound Name | 1-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-4-fluorobenzene |
|---|---|
| PubChem CID | 122578043 |
| Molecular Formula | C21H27F3O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-[[4-(4-ethylcyclohex-2-en-1-yl)cyclohexyl]-difluoromethoxy]-4-fluorobenzene |
| SMILES | CCC1C=CC(C2CCC(C(F)(F)Oc3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H27F3O/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)21(23,24)25-20-13-11-19(22)12-14-20/h3,5,11-18H,2,4,6-10H2,1H3 |
| InChIKey | KMIZIDZPORTVBQ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|