C26H38N4O5S — CID 122588033
ethyl 3-[4-[(2,2-dihydroxythian-4-yl)-ethylamino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]-3-methylbutanoate (PubChem CID 122588033) has the molecular formula C26H38N4O5S and a molecular weight of 518.68 g/mol. Its IUPAC name is ethyl 3-[4-[(2,2-dihydroxythian-4-yl)-ethylamino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]-3-methylbutanoate.
| Compound Name | ethyl 3-[4-[(2,2-dihydroxythian-4-yl)-ethylamino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 122588033 |
| Molecular Formula | C26H38N4O5S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | ethyl 3-[4-[(2,2-dihydroxythian-4-yl)-ethylamino]-3-[(2-ethoxypyrimidin-5-yl)amino]phenyl]-3-methylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)c1ccc(N(CC)C2CCSC(O)(O)C2)c(Nc2cnc(OCC)nc2)c1 |
| InChI | InChI=1S/C26H38N4O5S/c1-6-30(20-11-12-36-26(32,33)14-20)22-10-9-18(25(4,5)15-23(31)34-7-2)13-21(22)29-19-16-27-24(28-17-19)35-8-3/h9-10,13,16-17,20,29,32-33H,6-8,11-12,14-15H2,1-5H3 |
| InChIKey | HNWOBLVSBOWQJY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|