C30H30N6O9 — CID 122595443
[[4,6-bis[[2-(4-hydroxyphenyl)acetyl]oxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 2-(4-hydroxyphenyl)acetate (PubChem CID 122595443) has the molecular formula C30H30N6O9 and a molecular weight of 618.60 g/mol. Its IUPAC name is [[4,6-bis[[2-(4-hydroxyphenyl)acetyl]oxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 2-(4-hydroxyphenyl)acetate.
| Compound Name | [[4,6-bis[[2-(4-hydroxyphenyl)acetyl]oxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 2-(4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 122595443 |
| Molecular Formula | C30H30N6O9 |
| Molecular Weight | 618.60 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [[4,6-bis[[2-(4-hydroxyphenyl)acetyl]oxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 2-(4-hydroxyphenyl)acetate |
| SMILES | O=C(Cc1ccc(O)cc1)OCNc1nc(NCOC(=O)Cc2ccc(O)cc2)nc(NCOC(=O)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C30H30N6O9/c37-22-7-1-19(2-8-22)13-25(40)43-16-31-28-34-29(32-17-44-26(41)14-20-3-9-23(38)10-4-20)36-30(35-28)33-18-45-27(42)15-21-5-11-24(39)12-6-21/h1-12,37-39H,13-18H2,(H3,31,32,33,34,35,36) |
| InChIKey | NMPNRLVRSLKIRP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|