C18H33N9O9 — CID 59409293
[[4,6-bis[3-(hydroxymethylamino)propanoyloxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 3-(hydroxymethylamino)propanoate (PubChem CID 59409293) has the molecular formula C18H33N9O9 and a molecular weight of 519.52 g/mol. Its IUPAC name is [[4,6-bis[3-(hydroxymethylamino)propanoyloxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 3-(hydroxymethylamino)propanoate.
| Compound Name | [[4,6-bis[3-(hydroxymethylamino)propanoyloxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 3-(hydroxymethylamino)propanoate |
|---|---|
| PubChem CID | 59409293 |
| Molecular Formula | C18H33N9O9 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | [[4,6-bis[3-(hydroxymethylamino)propanoyloxymethylamino]-1,3,5-triazin-2-yl]amino]methyl 3-(hydroxymethylamino)propanoate |
| SMILES | O=C(CCNCO)OCNc1nc(NCOC(=O)CCNCO)nc(NCOC(=O)CCNCO)n1 |
| InChI | InChI=1S/C18H33N9O9/c28-7-19-4-1-13(31)34-10-22-16-25-17(23-11-35-14(32)2-5-20-8-29)27-18(26-16)24-12-36-15(33)3-6-21-9-30/h19-21,28-30H,1-12H2,(H3,22,23,24,25,26,27) |
| InChIKey | UJQNYMOMIRPBDJ-UHFFFAOYSA-N |
| XLogP | -3.60 |
| TPSA | 250.44 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|