C23H27IO2 — CID 122626678
1-[2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-iodophenyl]pentan-3-one (PubChem CID 122626678) has the molecular formula C23H27IO2 and a molecular weight of 462.37 g/mol. Its IUPAC name is 1-[2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-iodophenyl]pentan-3-one.
| Compound Name | 1-[2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-iodophenyl]pentan-3-one |
|---|---|
| PubChem CID | 122626678 |
| Molecular Formula | C23H27IO2 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-[2-[(2-cyclopropyl-4-ethylphenoxy)methyl]-3-iodophenyl]pentan-3-one |
| SMILES | CCC(=O)CCc1cccc(I)c1COc1ccc(CC)cc1C1CC1 |
| InChI | InChI=1S/C23H27IO2/c1-3-16-8-13-23(20(14-16)18-9-10-18)26-15-21-17(6-5-7-22(21)24)11-12-19(25)4-2/h5-8,13-14,18H,3-4,9-12,15H2,1-2H3 |
| InChIKey | ZVILTUUTMMYRGP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|