C14H26N4O4 — CID 122634037
ditert-butyl (2S)-2-[(2-methylidenehydrazinyl)diazenyl]pentanedioate (PubChem CID 122634037) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[(2-methylidenehydrazinyl)diazenyl]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[(2-methylidenehydrazinyl)diazenyl]pentanedioate |
|---|---|
| PubChem CID | 122634037 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | ditert-butyl (2S)-2-[(2-methylidenehydrazinyl)diazenyl]pentanedioate |
| SMILES | C=NN/N=N/[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26N4O4/c1-13(2,3)21-11(19)9-8-10(16-18-17-15-7)12(20)22-14(4,5)6/h10H,7-9H2,1-6H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | XXKWBQFVAKQHIT-JTQLQIEISA-N |
| XLogP | 2.39 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|