C17H24N2O — CID 122642796
6-ethyl-7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 122642796) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 6-ethyl-7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 6-ethyl-7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 122642796 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 6-ethyl-7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCc1cc2c3c([nH]c2cc1OC)CN(C(C)C)CC3 |
| InChI | InChI=1S/C17H24N2O/c1-5-12-8-14-13-6-7-19(11(2)3)10-16(13)18-15(14)9-17(12)20-4/h8-9,11,18H,5-7,10H2,1-4H3 |
| InChIKey | JKPVHRRFDQNJKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|