C16H22N2OS — CID 144820979
methanethione;7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 144820979) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is methanethione;7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | methanethione;7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 144820979 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methanethione;7-methoxy-2-propan-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=S.COc1ccc2c3c([nH]c2c1)CN(C(C)C)CC3 |
| InChI | InChI=1S/C15H20N2O.CH2S/c1-10(2)17-7-6-13-12-5-4-11(18-3)8-14(12)16-15(13)9-17;1-2/h4-5,8,10,16H,6-7,9H2,1-3H3;1H2 |
| InChIKey | RQAGCGIANNKXPK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|