C14H18N2O — CID 168762190
5,5-dideuterio-8-methoxy-3-(trideuteriomethyl)-1,2,4,6-tetrahydroazepino[4,5-b]indole (PubChem CID 168762190) has the molecular formula C14H18N2O and a molecular weight of 235.34 g/mol. Its IUPAC name is 5,5-dideuterio-8-methoxy-3-(trideuteriomethyl)-1,2,4,6-tetrahydroazepino[4,5-b]indole.
| Compound Name | 5,5-dideuterio-8-methoxy-3-(trideuteriomethyl)-1,2,4,6-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 168762190 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 5,5-dideuterio-8-methoxy-3-(trideuteriomethyl)-1,2,4,6-tetrahydroazepino[4,5-b]indole |
| SMILES | [2H]C1([2H])CN(C([2H])([2H])[2H])CCc2c1[nH]c1cc(OC)ccc21 |
| InChI | InChI=1S/C14H18N2O/c1-16-7-5-12-11-4-3-10(17-2)9-14(11)15-13(12)6-8-16/h3-4,9,15H,5-8H2,1-2H3/i1D3,6D2 |
| InChIKey | FNGNYGCPNKZYOG-YRYIGFSMSA-N |
| XLogP | 2.21 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|