C16H25N — CID 122643082
1-[(1E)-buta-1,3-dienyl]-4-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine (PubChem CID 122643082) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-4-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine.
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-4-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine |
|---|---|
| PubChem CID | 122643082 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-4-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine |
| SMILES | C=C/C=C/N1CCC(CC(/C=C\C)=C/C)CC1 |
| InChI | InChI=1S/C16H25N/c1-4-7-11-17-12-9-16(10-13-17)14-15(6-3)8-5-2/h4-8,11,16H,1,9-10,12-14H2,2-3H3/b8-5-,11-7+,15-6+ |
| InChIKey | XHCQJZTVLIQXAR-HNRNRMBASA-N |
| XLogP | 4.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|