C16H29F3O4 — CID 122663945
[2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-methylpropyl] 2,2-dimethylbutanoate (PubChem CID 122663945) has the molecular formula C16H29F3O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is [2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-methylpropyl] 2,2-dimethylbutanoate.
| Compound Name | [2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-methylpropyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122663945 |
| Molecular Formula | C16H29F3O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [2-(2,2-dimethylpropoxymethoxy)-3,3,3-trifluoro-2-methylpropyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(C)(OCOCC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H29F3O4/c1-8-14(5,6)12(20)22-10-15(7,16(17,18)19)23-11-21-9-13(2,3)4/h8-11H2,1-7H3 |
| InChIKey | UECWBVKBWAGAQD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|