C16H26F6O3 — CID 58937694
2,2,3,3,5,5-hexafluoropentyl 2-(2,2-dimethylpropoxymethyl)-2-methylbutanoate (PubChem CID 58937694) has the molecular formula C16H26F6O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 2,2,3,3,5,5-hexafluoropentyl 2-(2,2-dimethylpropoxymethyl)-2-methylbutanoate.
| Compound Name | 2,2,3,3,5,5-hexafluoropentyl 2-(2,2-dimethylpropoxymethyl)-2-methylbutanoate |
|---|---|
| PubChem CID | 58937694 |
| Molecular Formula | C16H26F6O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2,2,3,3,5,5-hexafluoropentyl 2-(2,2-dimethylpropoxymethyl)-2-methylbutanoate |
| SMILES | CCC(C)(COCC(C)(C)C)C(=O)OCC(F)(F)C(F)(F)CC(F)F |
| InChI | InChI=1S/C16H26F6O3/c1-6-14(5,9-24-8-13(2,3)4)12(23)25-10-16(21,22)15(19,20)7-11(17)18/h11H,6-10H2,1-5H3 |
| InChIKey | QPNVYAFWZDBAST-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|