C26H22ClO2P — CID 122666786
2-chlorophosphanyloxy-1,1,2,2-tetraphenylethanol (PubChem CID 122666786) has the molecular formula C26H22ClO2P and a molecular weight of 432.89 g/mol. Its IUPAC name is 2-chlorophosphanyloxy-1,1,2,2-tetraphenylethanol.
| Compound Name | 2-chlorophosphanyloxy-1,1,2,2-tetraphenylethanol |
|---|---|
| PubChem CID | 122666786 |
| Molecular Formula | C26H22ClO2P |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 2-chlorophosphanyloxy-1,1,2,2-tetraphenylethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)C(OPCl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22ClO2P/c27-30-29-26(23-17-9-3-10-18-23,24-19-11-4-12-20-24)25(28,21-13-5-1-6-14-21)22-15-7-2-8-16-22/h1-20,28,30H |
| InChIKey | IHWCEUUVNBDLJA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|