C14H14F3N3O6 — CID 122666886
2,2,2-trifluoro-N-[2-methoxy-4-(morpholine-4-carbonyl)-5-nitrophenyl]acetamide (PubChem CID 122666886) has the molecular formula C14H14F3N3O6 and a molecular weight of 377.28 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-methoxy-4-(morpholine-4-carbonyl)-5-nitrophenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-methoxy-4-(morpholine-4-carbonyl)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 122666886 |
| Molecular Formula | C14H14F3N3O6 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-methoxy-4-(morpholine-4-carbonyl)-5-nitrophenyl]acetamide |
| SMILES | COc1cc(C(=O)N2CCOCC2)c([N+](=O)[O-])cc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O6/c1-25-11-6-8(12(21)19-2-4-26-5-3-19)10(20(23)24)7-9(11)18-13(22)14(15,16)17/h6-7H,2-5H2,1H3,(H,18,22) |
| InChIKey | XHADKTCWTNSALK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|