C24H22F7NO2S — CID 122669049
9b-(4-cyclopropylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122669049) has the molecular formula C24H22F7NO2S and a molecular weight of 521.50 g/mol. Its IUPAC name is 9b-(4-cyclopropylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 9b-(4-cyclopropylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122669049 |
| Molecular Formula | C24H22F7NO2S |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 9b-(4-cyclopropylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | O=S(=O)(c1ccc(C2CC2)cc1)C12CCNC1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H22F7NO2S/c25-22(23(26,27)28,24(29,30)31)17-6-9-19-16(13-17)5-10-20-21(19,11-12-32-20)35(33,34)18-7-3-15(4-8-18)14-1-2-14/h3-4,6-9,13-14,20,32H,1-2,5,10-12H2 |
| InChIKey | IKWVAICMQNXWGA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |