C20H19BrN2O5S — CID 122675043
methyl 3-[(4Z)-6-bromo-4-[(4-methylphenyl)sulfonylhydrazinylidene]chromen-3-yl]propanoate (PubChem CID 122675043) has the molecular formula C20H19BrN2O5S and a molecular weight of 479.35 g/mol. Its IUPAC name is methyl 3-[(4Z)-6-bromo-4-[(4-methylphenyl)sulfonylhydrazinylidene]chromen-3-yl]propanoate.
| Compound Name | methyl 3-[(4Z)-6-bromo-4-[(4-methylphenyl)sulfonylhydrazinylidene]chromen-3-yl]propanoate |
|---|---|
| PubChem CID | 122675043 |
| Molecular Formula | C20H19BrN2O5S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | methyl 3-[(4Z)-6-bromo-4-[(4-methylphenyl)sulfonylhydrazinylidene]chromen-3-yl]propanoate |
| SMILES | COC(=O)CCc1coc2ccc(Br)cc2/c1=N\NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19BrN2O5S/c1-13-3-7-16(8-4-13)29(25,26)23-22-20-14(5-10-19(24)27-2)12-28-18-9-6-15(21)11-17(18)20/h3-4,6-9,11-12,23H,5,10H2,1-2H3/b22-20- |
| InChIKey | BWWPCWVGWHIOIN-XDOYNYLZSA-N |
| XLogP | 3.40 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|