C28H31F5N2O3S — CID 122676605
[9b-[(3-fluorophenyl)methyl]-5-methyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 122676605) has the molecular formula C28H31F5N2O3S and a molecular weight of 570.62 g/mol. Its IUPAC name is [9b-[(3-fluorophenyl)methyl]-5-methyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [9b-[(3-fluorophenyl)methyl]-5-methyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122676605 |
| Molecular Formula | C28H31F5N2O3S |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | [9b-[(3-fluorophenyl)methyl]-5-methyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | CN1CC2N(C(=O)C3CCS(=O)(=O)CC3)CCC2(Cc2cccc(F)c2)c2ccc(C(C)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C28H31F5N2O3S/c1-26(30,28(31,32)33)20-6-7-22-23(15-20)34(2)17-24-27(22,16-18-4-3-5-21(29)14-18)10-11-35(24)25(36)19-8-12-39(37,38)13-9-19/h3-7,14-15,19,24H,8-13,16-17H2,1-2H3 |
| InChIKey | WNARZWFHDQHSIV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |