C23H25F5N2 — CID 122676648
9b-[(4-fluorophenyl)methyl]-3,5-dimethyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline (PubChem CID 122676648) has the molecular formula C23H25F5N2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 9b-[(4-fluorophenyl)methyl]-3,5-dimethyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline.
| Compound Name | 9b-[(4-fluorophenyl)methyl]-3,5-dimethyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 122676648 |
| Molecular Formula | C23H25F5N2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 9b-[(4-fluorophenyl)methyl]-3,5-dimethyl-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline |
| SMILES | CN1CC2N(C)CCC2(Cc2ccc(F)cc2)c2ccc(C(C)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C23H25F5N2/c1-21(25,23(26,27)28)16-6-9-18-19(12-16)30(3)14-20-22(18,10-11-29(20)2)13-15-4-7-17(24)8-5-15/h4-9,12,20H,10-11,13-14H2,1-3H3 |
| InChIKey | CZZWBLXYDHKGEG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |