C15H18FN5O3S — CID 122699834
4-[5-[(3S)-3-fluoropiperidin-1-yl]-6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine (PubChem CID 122699834) has the molecular formula C15H18FN5O3S and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-[5-[(3S)-3-fluoropiperidin-1-yl]-6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine.
| Compound Name | 4-[5-[(3S)-3-fluoropiperidin-1-yl]-6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine |
|---|---|
| PubChem CID | 122699834 |
| Molecular Formula | C15H18FN5O3S |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-[5-[(3S)-3-fluoropiperidin-1-yl]-6-nitro-[1,3]thiazolo[4,5-b]pyridin-2-yl]morpholine |
| SMILES | O=[N+]([O-])c1cc2sc(N3CCOCC3)nc2nc1N1CCC[C@H](F)C1 |
| InChI | InChI=1S/C15H18FN5O3S/c16-10-2-1-3-20(9-10)14-11(21(22)23)8-12-13(17-14)18-15(25-12)19-4-6-24-7-5-19/h8,10H,1-7,9H2/t10-/m0/s1 |
| InChIKey | MWAVAADEVDFXGJ-JTQLQIEISA-N |
| XLogP | 2.37 |
| TPSA | 84.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|