C28H42N2O — CID 122703848
(5Z,8Z,11Z,14Z)-20-[2-(dimethylamino)phenyl]icosa-5,8,11,14-tetraenamide (PubChem CID 122703848) has the molecular formula C28H42N2O and a molecular weight of 422.66 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-20-[2-(dimethylamino)phenyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-20-[2-(dimethylamino)phenyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 122703848 |
| Molecular Formula | C28H42N2O |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.33 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-20-[2-(dimethylamino)phenyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CN(C)c1ccccc1CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(N)=O |
| InChI | InChI=1S/C28H42N2O/c1-30(2)27-24-21-20-23-26(27)22-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-25-28(29)31/h3-4,7-10,13,15,20-21,23-24H,5-6,11-12,14,16-19,22,25H2,1-2H3,(H2,29,31)/b4-3-,9-7-,10-8-,15-13- |
| InChIKey | JZJUBEXBFVTTHK-JPZBVVEWSA-N |
| XLogP | 6.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|