C26H27ClN2O5 — CID 123142818
4-[4-[1-(4-chloro-2-methylphenyl)-3-(1-methyl-6-oxo-3-pyridinyl)-3-nitrosopropyl]phenoxy]butanoic acid (PubChem CID 123142818) has the molecular formula C26H27ClN2O5 and a molecular weight of 482.96 g/mol. Its IUPAC name is 4-[4-[1-(4-chloro-2-methylphenyl)-3-(1-methyl-6-oxo-3-pyridinyl)-3-nitrosopropyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[1-(4-chloro-2-methylphenyl)-3-(1-methyl-6-oxo-3-pyridinyl)-3-nitrosopropyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 123142818 |
| Molecular Formula | C26H27ClN2O5 |
| Molecular Weight | 482.96 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 4-[4-[1-(4-chloro-2-methylphenyl)-3-(1-methyl-6-oxo-3-pyridinyl)-3-nitrosopropyl]phenoxy]butanoic acid |
| SMILES | Cc1cc(Cl)ccc1C(CC(N=O)c1ccc(=O)n(C)c1)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C26H27ClN2O5/c1-17-14-20(27)8-11-22(17)23(15-24(28-33)19-7-12-25(30)29(2)16-19)18-5-9-21(10-6-18)34-13-3-4-26(31)32/h5-12,14,16,23-24H,3-4,13,15H2,1-2H3,(H,31,32) |
| InChIKey | ITSABEDSRIFMND-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.96 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|