C17H23N3 — CID 123147386
3-[1-[(5Z)-3,4,7,8-tetrahydro-2H-azonin-9-yl]ethylideneamino]cyclohepta-2,4-dien-1-imine (PubChem CID 123147386) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[1-[(5Z)-3,4,7,8-tetrahydro-2H-azonin-9-yl]ethylideneamino]cyclohepta-2,4-dien-1-imine.
| Compound Name | 3-[1-[(5Z)-3,4,7,8-tetrahydro-2H-azonin-9-yl]ethylideneamino]cyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123147386 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-[1-[(5Z)-3,4,7,8-tetrahydro-2H-azonin-9-yl]ethylideneamino]cyclohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=C(/N=C(C)/C2=N/CCC/C=C\CC2)C=CCC1 |
| InChI | InChI=1S/C17H23N3/c1-14(17-11-5-3-2-4-8-12-19-17)20-16-10-7-6-9-15(18)13-16/h2-3,7,10,13,18H,4-6,8-9,11-12H2,1H3/b3-2-,18-15+,19-17+,20-14+ |
| InChIKey | BBEAGHQGTIMQOG-WFLCNOBNSA-N |
| XLogP | 4.27 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|