C17H24N2 — CID 142233041
(3E,5Z,6Z)-2-(cyclopenta-1,3-dien-1-ylmethylimino)-5-ethylidenenona-3,6-dien-3-amine (PubChem CID 142233041) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (3E,5Z,6Z)-2-(cyclopenta-1,3-dien-1-ylmethylimino)-5-ethylidenenona-3,6-dien-3-amine.
| Compound Name | (3E,5Z,6Z)-2-(cyclopenta-1,3-dien-1-ylmethylimino)-5-ethylidenenona-3,6-dien-3-amine |
|---|---|
| PubChem CID | 142233041 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (3E,5Z,6Z)-2-(cyclopenta-1,3-dien-1-ylmethylimino)-5-ethylidenenona-3,6-dien-3-amine |
| SMILES | C/C=C(/C=C\CC)\C=C(N)/C(C)=N/CC1=CC=CC1 |
| InChI | InChI=1S/C17H24N2/c1-4-6-9-15(5-2)12-17(18)14(3)19-13-16-10-7-8-11-16/h5-10,12H,4,11,13,18H2,1-3H3/b9-6-,15-5-,17-12+,19-14+ |
| InChIKey | YOFUOKMIGCLFNG-GQFHSNDOSA-N |
| XLogP | 4.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|