C22H16N4 — CID 66605417
2-ethylporphyrin (PubChem CID 66605417) has the molecular formula C22H16N4 and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-ethylporphyrin.
| Compound Name | 2-ethylporphyrin |
|---|---|
| PubChem CID | 66605417 |
| Molecular Formula | C22H16N4 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-ethylporphyrin |
| SMILES | CCC1=CC2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C22H16N4/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21/h3-13H,2H2,1H3/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,21-12-,22-13- |
| InChIKey | JTUMRGJDMMRZIF-LGRBBWKFSA-N |
| XLogP | 4.36 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |