C13H20N2O — CID 123160009
(2E,4E)-N-cyclopropyl-2-ethyl-7-imino-5-methylhepta-2,4-dienamide (PubChem CID 123160009) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is (2E,4E)-N-cyclopropyl-2-ethyl-7-imino-5-methylhepta-2,4-dienamide.
| Compound Name | (2E,4E)-N-cyclopropyl-2-ethyl-7-imino-5-methylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 123160009 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | (2E,4E)-N-cyclopropyl-2-ethyl-7-imino-5-methylhepta-2,4-dienamide |
| SMILES | [H]/N=C/C/C(C)=C/C=C(\CC)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H20N2O/c1-3-11(5-4-10(2)8-9-14)13(16)15-12-6-7-12/h4-5,9,12,14H,3,6-8H2,1-2H3,(H,15,16)/b10-4+,11-5+,14-9+ |
| InChIKey | TUXJKEPBEWLHHU-GSSKNFACSA-N |
| XLogP | 2.59 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|