C31H36F2N4O5Si — CID 123167022
methyl 3-[[5-[4-[5-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate (PubChem CID 123167022) has the molecular formula C31H36F2N4O5Si and a molecular weight of 610.73 g/mol. Its IUPAC name is methyl 3-[[5-[4-[5-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[5-[4-[5-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123167022 |
| Molecular Formula | C31H36F2N4O5Si |
| Molecular Weight | 610.73 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | methyl 3-[[5-[4-[5-(2,4-difluorophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(Oc4ccc(F)cc4F)n(COCC[Si](C)(C)C)n3)cc2)cn1 |
| InChI | InChI=1S/C31H36F2N4O5Si/c1-31(2,29(38)39-3)19-41-27-14-11-23(18-34-27)21-7-9-22(10-8-21)28-35-30(42-26-13-12-24(32)17-25(26)33)37(36-28)20-40-15-16-43(4,5)6/h7-14,17-18H,15-16,19-20H2,1-6H3 |
| InChIKey | SOEHPTZIGXCXMC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.73 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|