C17H10O3 — CID 123167864
2-methoxypyrene-1,8-dione (PubChem CID 123167864) has the molecular formula C17H10O3 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-methoxypyrene-1,8-dione.
| Compound Name | 2-methoxypyrene-1,8-dione |
|---|---|
| PubChem CID | 123167864 |
| Molecular Formula | C17H10O3 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-methoxypyrene-1,8-dione |
| SMILES | COC1=Cc2ccc3c4c(ccc(c24)C1=O)C(=O)C=C3 |
| InChI | InChI=1S/C17H10O3/c1-20-14-8-10-3-2-9-4-7-13(18)11-5-6-12(17(14)19)16(10)15(9)11/h2-8H,1H3 |
| InChIKey | HWHYFODQGVWISY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |