C37H44O7 — CID 123177585
3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-propyloxan-2-yl]prop-2-en-1-one (PubChem CID 123177585) has the molecular formula C37H44O7 and a molecular weight of 600.75 g/mol. Its IUPAC name is 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-propyloxan-2-yl]prop-2-en-1-one.
| Compound Name | 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-propyloxan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123177585 |
| Molecular Formula | C37H44O7 |
| Molecular Weight | 600.75 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | 3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2S,3S,4R,5S)-3,4,5-tris(phenylmethoxy)-6-propyloxan-2-yl]prop-2-en-1-one |
| SMILES | CCCC1O[C@H](C(=O)C=C[C@H]2COC(C)(C)O2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H44O7/c1-4-14-32-34(39-23-27-15-8-5-9-16-27)36(41-25-29-19-12-7-13-20-29)35(40-24-28-17-10-6-11-18-28)33(43-32)31(38)22-21-30-26-42-37(2,3)44-30/h5-13,15-22,30,32-36H,4,14,23-26H2,1-3H3/t30-,32?,33+,34-,35+,36+/m0/s1 |
| InChIKey | CDOQJWWPVXQCCM-IJALBKDJSA-N |
| XLogP | 6.59 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|