C11H7NO2S — CID 123178524
1-methyl-[1]benzothiolo[3,2-b]pyrrole-2,3-dione (PubChem CID 123178524) has the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. Its IUPAC name is 1-methyl-[1]benzothiolo[3,2-b]pyrrole-2,3-dione.
| Compound Name | 1-methyl-[1]benzothiolo[3,2-b]pyrrole-2,3-dione |
|---|---|
| PubChem CID | 123178524 |
| Molecular Formula | C11H7NO2S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 1-methyl-[1]benzothiolo[3,2-b]pyrrole-2,3-dione |
| SMILES | CN1C(=O)C(=O)c2sc3ccccc3c21 |
| InChI | InChI=1S/C11H7NO2S/c1-12-8-6-4-2-3-5-7(6)15-10(8)9(13)11(12)14/h2-5H,1H3 |
| InChIKey | XGDNGEZOEURDKM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|