About 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane
9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane (PubChem CID 123181000) has the molecular formula C22H46
and a molecular weight of 310.61 g/mol. Its IUPAC name is 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane.
Molecular Properties
| Compound Name | 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane |
| PubChem CID | 123181000 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane |
| SMILES | CCCC(CC)CC(CC(C)CCCC(C)CC)C(C)CC |
| InChI | InChI=1S/C22H46/c1-8-13-21(11-4)17-22(20(7)10-3)16-19(6)15-12-14-18(5)9-2/h18-22H,8-17H2,1-7H3 |
| InChIKey | CLKIYWDCNIDRJF-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane?
The IUPAC name of 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane (CID 123181000) is 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane.
What is the SMILES notation for 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane?
The canonical SMILES for 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane is CCCC(CC)CC(CC(C)CCCC(C)CC)C(C)CC.
What is the InChIKey of 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane?
The InChIKey is CLKIYWDCNIDRJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46/c1-8-13-21(11-4)17-22(20(7)10-3)16-19(6)15-12-14-18(5)9-2/h18-22H,8-17H2,1-7H3.
What are the key properties of 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane?
9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane has a molecular weight of 310.61 g/mol, XLogP of 8.11, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butan-2-yl-11-ethyl-3,7-dimethyltetradecane is sourced from PubChem (CID 123181000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).