C23H25NO5 — CID 123187448
1-[(1S)-1-[4-[(2S)-1-methoxy-3-oxopropan-2-yl]oxyphenyl]ethyl]-2,3-dimethylindole-5-carboxylic acid (PubChem CID 123187448) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[(1S)-1-[4-[(2S)-1-methoxy-3-oxopropan-2-yl]oxyphenyl]ethyl]-2,3-dimethylindole-5-carboxylic acid.
| Compound Name | 1-[(1S)-1-[4-[(2S)-1-methoxy-3-oxopropan-2-yl]oxyphenyl]ethyl]-2,3-dimethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 123187448 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[(1S)-1-[4-[(2S)-1-methoxy-3-oxopropan-2-yl]oxyphenyl]ethyl]-2,3-dimethylindole-5-carboxylic acid |
| SMILES | COC[C@@H](C=O)Oc1ccc([C@H](C)n2c(C)c(C)c3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-14-15(2)24(22-10-7-18(23(26)27)11-21(14)22)16(3)17-5-8-19(9-6-17)29-20(12-25)13-28-4/h5-12,16,20H,13H2,1-4H3,(H,26,27)/t16-,20+/m0/s1 |
| InChIKey | SQMNISVGCLLIII-OXJNMPFZSA-N |
| XLogP | 4.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|