C17H20FNO2 — CID 70158025
3-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-2-fluorobut-2-enoic acid (PubChem CID 70158025) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-2-fluorobut-2-enoic acid.
| Compound Name | 3-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-2-fluorobut-2-enoic acid |
|---|---|
| PubChem CID | 70158025 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-(2,3-dimethyl-1-propan-2-ylindol-5-yl)-2-fluorobut-2-enoic acid |
| SMILES | CC(=C(F)C(=O)O)c1ccc2c(c1)c(C)c(C)n2C(C)C |
| InChI | InChI=1S/C17H20FNO2/c1-9(2)19-12(5)10(3)14-8-13(6-7-15(14)19)11(4)16(18)17(20)21/h6-9H,1-5H3,(H,20,21) |
| InChIKey | ZBJPGCGXCAKNSP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|