C30H35N2+ — CID 123191078
4-(7-butyl-6-ethyl-3-methyl-7-propyl-6H-benzo[a]quinolizin-5-ium-10-yl)benzonitrile (PubChem CID 123191078) has the molecular formula C30H35N2+ and a molecular weight of 423.62 g/mol. Its IUPAC name is 4-(7-butyl-6-ethyl-3-methyl-7-propyl-6H-benzo[a]quinolizin-5-ium-10-yl)benzonitrile.
| Compound Name | 4-(7-butyl-6-ethyl-3-methyl-7-propyl-6H-benzo[a]quinolizin-5-ium-10-yl)benzonitrile |
|---|---|
| PubChem CID | 123191078 |
| Molecular Formula | C30H35N2+ |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 4-(7-butyl-6-ethyl-3-methyl-7-propyl-6H-benzo[a]quinolizin-5-ium-10-yl)benzonitrile |
| SMILES | CCCCC1(CCC)c2ccc(-c3ccc(C#N)cc3)cc2-c2ccc(C)c[n+]2C1CC |
| InChI | InChI=1S/C30H35N2/c1-5-8-18-30(17-6-2)27-15-14-25(24-12-10-23(20-31)11-13-24)19-26(27)28-16-9-22(4)21-32(28)29(30)7-3/h9-16,19,21,29H,5-8,17-18H2,1-4H3/q+1 |
| InChIKey | BGHNTQSLWJMIGM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|