C24H31F3N6O — CID 123191786
2-[amino-[6-[3-ethenyl-4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-4-(1-methylcyclopropyl)oxyaniline (PubChem CID 123191786) has the molecular formula C24H31F3N6O and a molecular weight of 476.55 g/mol. Its IUPAC name is 2-[amino-[6-[3-ethenyl-4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-4-(1-methylcyclopropyl)oxyaniline.
| Compound Name | 2-[amino-[6-[3-ethenyl-4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-4-(1-methylcyclopropyl)oxyaniline |
|---|---|
| PubChem CID | 123191786 |
| Molecular Formula | C24H31F3N6O |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[amino-[6-[3-ethenyl-4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyrimidin-4-yl]methyl]-4-(1-methylcyclopropyl)oxyaniline |
| SMILES | C=CC1CN(c2cc(C(N)c3cc(OC4(C)CC4)ccc3N)ncn2)CCN1CCC(F)(F)F |
| InChI | InChI=1S/C24H31F3N6O/c1-3-16-14-33(11-10-32(16)9-8-24(25,26)27)21-13-20(30-15-31-21)22(29)18-12-17(4-5-19(18)28)34-23(2)6-7-23/h3-5,12-13,15-16,22H,1,6-11,14,28-29H2,2H3 |
| InChIKey | ATTLAXNOIJEDCM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|