C20H43N2+ — CID 123198153
[3-(aminomethyl)-2,7-dimethylnon-1-en-4-yl]-dimethyl-(2-methylpentyl)azanium (PubChem CID 123198153) has the molecular formula C20H43N2+ and a molecular weight of 311.58 g/mol. Its IUPAC name is [3-(aminomethyl)-2,7-dimethylnon-1-en-4-yl]-dimethyl-(2-methylpentyl)azanium.
| Compound Name | [3-(aminomethyl)-2,7-dimethylnon-1-en-4-yl]-dimethyl-(2-methylpentyl)azanium |
|---|---|
| PubChem CID | 123198153 |
| Molecular Formula | C20H43N2+ |
| Molecular Weight | 311.58 g/mol |
| Exact Mass | 311.34 |
| IUPAC Name | [3-(aminomethyl)-2,7-dimethylnon-1-en-4-yl]-dimethyl-(2-methylpentyl)azanium |
| SMILES | C=C(C)C(CN)C(CCC(C)CC)[N+](C)(C)CC(C)CCC |
| InChI | InChI=1S/C20H43N2/c1-9-11-18(6)15-22(7,8)20(13-12-17(5)10-2)19(14-21)16(3)4/h17-20H,3,9-15,21H2,1-2,4-8H3/q+1 |
| InChIKey | SGXKFGNNICVBRI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|