C7H15BO4 — CID 123206771
[6-(hydroxymethyl)-2-methyl-1,3,2-dioxaborepan-5-yl]methanol (PubChem CID 123206771) has the molecular formula C7H15BO4 and a molecular weight of 174.00 g/mol. Its IUPAC name is [6-(hydroxymethyl)-2-methyl-1,3,2-dioxaborepan-5-yl]methanol.
| Compound Name | [6-(hydroxymethyl)-2-methyl-1,3,2-dioxaborepan-5-yl]methanol |
|---|---|
| PubChem CID | 123206771 |
| Molecular Formula | C7H15BO4 |
| Molecular Weight | 174.00 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | [6-(hydroxymethyl)-2-methyl-1,3,2-dioxaborepan-5-yl]methanol |
| SMILES | CB1OCC(CO)C(CO)CO1 |
| InChI | InChI=1S/C7H15BO4/c1-8-11-4-6(2-9)7(3-10)5-12-8/h6-7,9-10H,2-5H2,1H3 |
| InChIKey | RWWYEYHMDSETLD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.00 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|