C26H25ClFN5O2 — CID 123208503
4-[4-(3-chloro-4-fluoroanilino)-7-[2-(oxolan-2-yl)ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 123208503) has the molecular formula C26H25ClFN5O2 and a molecular weight of 493.97 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluoroanilino)-7-[2-(oxolan-2-yl)ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | 4-[4-(3-chloro-4-fluoroanilino)-7-[2-(oxolan-2-yl)ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 123208503 |
| Molecular Formula | C26H25ClFN5O2 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 4-[4-(3-chloro-4-fluoroanilino)-7-[2-(oxolan-2-yl)ethynyl]quinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)C(C=CC(N)=O)c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1C#CC1CCCO1 |
| InChI | InChI=1S/C26H25ClFN5O2/c1-33(2)24(9-10-25(29)34)19-14-20-23(12-16(19)5-7-18-4-3-11-35-18)30-15-31-26(20)32-17-6-8-22(28)21(27)13-17/h6,8-10,12-15,18,24H,3-4,11H2,1-2H3,(H2,29,34)(H,30,31,32) |
| InChIKey | ADQFOTPYDWDXSZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|