C3H5N3S4 — CID 123213454
1,6-bis(sulfanyl)-1,3,5-triazinane-2,4-dithione (PubChem CID 123213454) has the molecular formula C3H5N3S4 and a molecular weight of 211.36 g/mol. Its IUPAC name is 1,6-bis(sulfanyl)-1,3,5-triazinane-2,4-dithione.
| Compound Name | 1,6-bis(sulfanyl)-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 123213454 |
| Molecular Formula | C3H5N3S4 |
| Molecular Weight | 211.36 g/mol |
| Exact Mass | 210.94 |
| IUPAC Name | 1,6-bis(sulfanyl)-1,3,5-triazinane-2,4-dithione |
| SMILES | S=C1NC(=S)N(S)C(S)N1 |
| InChI | InChI=1S/C3H5N3S4/c7-1-4-2(8)6(10)3(9)5-1/h2,8,10H,(H2,4,5,7,9) |
| InChIKey | JZCGWZHAWVVKLD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|