C15H30N4S2 — CID 150965399
1-amino-6-dodecyl-1,3,5-triazinane-2,4-dithione (PubChem CID 150965399) has the molecular formula C15H30N4S2 and a molecular weight of 330.57 g/mol. Its IUPAC name is 1-amino-6-dodecyl-1,3,5-triazinane-2,4-dithione.
| Compound Name | 1-amino-6-dodecyl-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 150965399 |
| Molecular Formula | C15H30N4S2 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-amino-6-dodecyl-1,3,5-triazinane-2,4-dithione |
| SMILES | CCCCCCCCCCCCC1NC(=S)NC(=S)N1N |
| InChI | InChI=1S/C15H30N4S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-14(20)18-15(21)19(13)16/h13H,2-12,16H2,1H3,(H2,17,18,20,21) |
| InChIKey | LMYVRPTUADMUGF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|