C6H8N2S2 — CID 131861436
5-prop-1-enylimidazolidine-2,4-dithione (PubChem CID 131861436) has the molecular formula C6H8N2S2 and a molecular weight of 172.28 g/mol. Its IUPAC name is 5-prop-1-enylimidazolidine-2,4-dithione.
| Compound Name | 5-prop-1-enylimidazolidine-2,4-dithione |
|---|---|
| PubChem CID | 131861436 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 5-prop-1-enylimidazolidine-2,4-dithione |
| SMILES | CC=CC1NC(=S)NC1=S |
| InChI | InChI=1S/C6H8N2S2/c1-2-3-4-5(9)8-6(10)7-4/h2-4H,1H3,(H2,7,8,9,10) |
| InChIKey | HLDBCAXXPHPKGZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|