About 2-prop-1-enyl-1,3-thiazolidin-4-one
2-prop-1-enyl-1,3-thiazolidin-4-one (PubChem CID 142636139) has the molecular formula C6H9NOS
and a molecular weight of 143.21 g/mol. Its IUPAC name is 2-prop-1-enyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-prop-1-enyl-1,3-thiazolidin-4-one |
| PubChem CID | 142636139 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 2-prop-1-enyl-1,3-thiazolidin-4-one |
| SMILES | CC=CC1NC(=O)CS1 |
| InChI | InChI=1S/C6H9NOS/c1-2-3-6-7-5(8)4-9-6/h2-3,6H,4H2,1H3,(H,7,8) |
| InChIKey | DMRVBSMKINQQSF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-1-enyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-1-enyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-prop-1-enyl-1,3-thiazolidin-4-one (CID 142636139) is 2-prop-1-enyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-prop-1-enyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-prop-1-enyl-1,3-thiazolidin-4-one is CC=CC1NC(=O)CS1.
What is the InChIKey of 2-prop-1-enyl-1,3-thiazolidin-4-one?
The InChIKey is DMRVBSMKINQQSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NOS/c1-2-3-6-7-5(8)4-9-6/h2-3,6H,4H2,1H3,(H,7,8).
What are the key properties of 2-prop-1-enyl-1,3-thiazolidin-4-one?
2-prop-1-enyl-1,3-thiazolidin-4-one has a molecular weight of 143.21 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-1-enyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 142636139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).