C6H9NOS — CID 142636139
2-prop-1-enyl-1,3-thiazolidin-4-one (PubChem CID 142636139) has the molecular formula C6H9NOS and a molecular weight of 143.21 g/mol. Its IUPAC name is 2-prop-1-enyl-1,3-thiazolidin-4-one.
| Compound Name | 2-prop-1-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142636139 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 2-prop-1-enyl-1,3-thiazolidin-4-one |
| SMILES | CC=CC1NC(=O)CS1 |
| InChI | InChI=1S/C6H9NOS/c1-2-3-6-7-5(8)4-9-6/h2-3,6H,4H2,1H3,(H,7,8) |
| InChIKey | DMRVBSMKINQQSF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|