C4H7NOS2 — CID 144806375
2-methylsulfanyl-1,3-thiazolidin-4-one (PubChem CID 144806375) has the molecular formula C4H7NOS2 and a molecular weight of 149.24 g/mol. Its IUPAC name is 2-methylsulfanyl-1,3-thiazolidin-4-one.
| Compound Name | 2-methylsulfanyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 144806375 |
| Molecular Formula | C4H7NOS2 |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.00 |
| IUPAC Name | 2-methylsulfanyl-1,3-thiazolidin-4-one |
| SMILES | CSC1NC(=O)CS1 |
| InChI | InChI=1S/C4H7NOS2/c1-7-4-5-3(6)2-8-4/h4H,2H2,1H3,(H,5,6) |
| InChIKey | RNWSZKUVTRMULZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |