C18H19F3N4O2 — CID 123215620
2-[(1R,3R,4S)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetic acid (PubChem CID 123215620) has the molecular formula C18H19F3N4O2 and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-[(1R,3R,4S)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetic acid.
| Compound Name | 2-[(1R,3R,4S)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetic acid |
|---|---|
| PubChem CID | 123215620 |
| Molecular Formula | C18H19F3N4O2 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[(1R,3R,4S)-3-ethyl-4-[10-(trifluoromethyl)-1,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentyl]acetic acid |
| SMILES | CC[C@@H]1C[C@@H](CC(=O)O)C[C@@H]1c1nc(C(F)(F)F)c2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C18H19F3N4O2/c1-2-10-5-9(7-14(26)27)6-11(10)17-24-15(18(19,20)21)13-8-23-16-12(25(13)17)3-4-22-16/h3-4,8-11,22H,2,5-7H2,1H3,(H,26,27)/t9-,10-,11+/m1/s1 |
| InChIKey | KXAJSKMFDKLSFJ-MXWKQRLJSA-N |
| XLogP | 4.22 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |