C21H29BN2O2 — CID 123217350
2-but-3-enyl-4,5-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazole (PubChem CID 123217350) has the molecular formula C21H29BN2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is 2-but-3-enyl-4,5-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazole.
| Compound Name | 2-but-3-enyl-4,5-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazole |
|---|---|
| PubChem CID | 123217350 |
| Molecular Formula | C21H29BN2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 2-but-3-enyl-4,5-dimethyl-1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]imidazole |
| SMILES | C=CCCc1nc(C)c(C)n1-c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C21H29BN2O2/c1-8-9-13-19-23-15(2)16(3)24(19)18-12-10-11-17(14-18)22-25-20(4,5)21(6,7)26-22/h8,10-12,14H,1,9,13H2,2-7H3 |
| InChIKey | CJEFPMAPSNLUAN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|