C47H44F4N2O3S — CID 123229889
[[[11-(2-ethylhexyl)-5-[(2-methylphenyl)methyl]benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate (PubChem CID 123229889) has the molecular formula C47H44F4N2O3S and a molecular weight of 792.94 g/mol. Its IUPAC name is [[[11-(2-ethylhexyl)-5-[(2-methylphenyl)methyl]benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate.
| Compound Name | [[[11-(2-ethylhexyl)-5-[(2-methylphenyl)methyl]benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123229889 |
| Molecular Formula | C47H44F4N2O3S |
| Molecular Weight | 792.94 g/mol |
| Exact Mass | 792.30 |
| IUPAC Name | [[[11-(2-ethylhexyl)-5-[(2-methylphenyl)methyl]benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] thiophene-2-carboxylate |
| SMILES | CCCCC(CC)Cn1c2ccc(C(=NOC(=O)c3cccs3)c3ccccc3OCC(F)(F)C(F)F)cc2c2cc(Cc3ccccc3C)c3ccccc3c21 |
| InChI | InChI=1S/C47H44F4N2O3S/c1-4-6-15-31(5-2)28-53-40-23-22-33(26-38(40)39-27-34(25-32-16-8-7-14-30(32)3)35-17-9-10-18-36(35)44(39)53)43(52-56-45(54)42-21-13-24-57-42)37-19-11-12-20-41(37)55-29-47(50,51)46(48)49/h7-14,16-24,26-27,31,46H,4-6,15,25,28-29H2,1-3H3 |
| InChIKey | CSURNFFFGSHUQZ-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.94 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|