C51H42N2O7S2 — CID 123229973
[4-[3-[2-(methylsulfonylcarbamoyl)indol-1-yl]propoxy]naphthalen-1-yl] 3-(3-naphthalen-1-yloxypropyl)-6-phenyl-1-benzothiophene-2-carboxylate (PubChem CID 123229973) has the molecular formula C51H42N2O7S2 and a molecular weight of 859.04 g/mol. Its IUPAC name is [4-[3-[2-(methylsulfonylcarbamoyl)indol-1-yl]propoxy]naphthalen-1-yl] 3-(3-naphthalen-1-yloxypropyl)-6-phenyl-1-benzothiophene-2-carboxylate.
| Compound Name | [4-[3-[2-(methylsulfonylcarbamoyl)indol-1-yl]propoxy]naphthalen-1-yl] 3-(3-naphthalen-1-yloxypropyl)-6-phenyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 123229973 |
| Molecular Formula | C51H42N2O7S2 |
| Molecular Weight | 859.04 g/mol |
| Exact Mass | 858.24 |
| IUPAC Name | [4-[3-[2-(methylsulfonylcarbamoyl)indol-1-yl]propoxy]naphthalen-1-yl] 3-(3-naphthalen-1-yloxypropyl)-6-phenyl-1-benzothiophene-2-carboxylate |
| SMILES | CS(=O)(=O)NC(=O)c1cc2ccccc2n1CCCOc1ccc(OC(=O)c2sc3cc(-c4ccccc4)ccc3c2CCCOc2cccc3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C51H42N2O7S2/c1-62(56,57)52-50(54)44-32-37-17-6-10-23-43(37)53(44)29-13-31-59-46-27-28-47(40-21-9-8-20-39(40)46)60-51(55)49-42(22-12-30-58-45-24-11-18-35-16-5-7-19-38(35)45)41-26-25-36(33-48(41)61-49)34-14-3-2-4-15-34/h2-11,14-21,23-28,32-33H,12-13,22,29-31H2,1H3,(H,52,54) |
| InChIKey | HIPOTSCOUNJUIU-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.04 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|